C14H11F4N3O2 — CID 166876065
2-fluoro-N-(2-methylprop-2-enyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 166876065) has the molecular formula C14H11F4N3O2 and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-fluoro-N-(2-methylprop-2-enyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | 2-fluoro-N-(2-methylprop-2-enyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 166876065 |
| Molecular Formula | C14H11F4N3O2 |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-fluoro-N-(2-methylprop-2-enyl)-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | C=C(C)CNC(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C14H11F4N3O2/c1-7(2)6-19-12(22)9-4-3-8(5-10(9)15)11-20-13(23-21-11)14(16,17)18/h3-5H,1,6H2,2H3,(H,19,22) |
| InChIKey | QFFAMONDGZAVEB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|