C15H9F8N3O2 — CID 138489768
2-fluoro-N-[(2,2,3,3-tetrafluorocyclobutyl)methyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide (PubChem CID 138489768) has the molecular formula C15H9F8N3O2 and a molecular weight of 415.24 g/mol. Its IUPAC name is 2-fluoro-N-[(2,2,3,3-tetrafluorocyclobutyl)methyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide.
| Compound Name | 2-fluoro-N-[(2,2,3,3-tetrafluorocyclobutyl)methyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
|---|---|
| PubChem CID | 138489768 |
| Molecular Formula | C15H9F8N3O2 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-fluoro-N-[(2,2,3,3-tetrafluorocyclobutyl)methyl]-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]benzamide |
| SMILES | O=C(NCC1CC(F)(F)C1(F)F)c1ccc(-c2noc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C15H9F8N3O2/c16-9-3-6(10-25-12(28-26-10)15(21,22)23)1-2-8(9)11(27)24-5-7-4-13(17,18)14(7,19)20/h1-3,7H,4-5H2,(H,24,27) |
| InChIKey | LYOALJJVFXWEDC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|