C13H12F3N3O4 — CID 153313569
ethyl N-methoxy-N-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]carbamate (PubChem CID 153313569) has the molecular formula C13H12F3N3O4 and a molecular weight of 331.25 g/mol. Its IUPAC name is ethyl N-methoxy-N-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]carbamate.
| Compound Name | ethyl N-methoxy-N-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 153313569 |
| Molecular Formula | C13H12F3N3O4 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | ethyl N-methoxy-N-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]carbamate |
| SMILES | CCOC(=O)N(OC)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C13H12F3N3O4/c1-3-22-12(20)19(21-2)9-6-4-8(5-7-9)10-17-11(23-18-10)13(14,15)16/h4-7H,3H2,1-2H3 |
| InChIKey | BJPJOEBMLKGLQN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|