C16H17F3N4O3 — CID 146253899
(Z)-1-morpholin-4-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanimine (PubChem CID 146253899) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is (Z)-1-morpholin-4-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanimine.
| Compound Name | (Z)-1-morpholin-4-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanimine |
|---|---|
| PubChem CID | 146253899 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (Z)-1-morpholin-4-yl-N-[[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methoxy]ethanimine |
| SMILES | C/C(=N/OCc1ccc(-c2noc(C(F)(F)F)n2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C16H17F3N4O3/c1-11(23-6-8-24-9-7-23)21-25-10-12-2-4-13(5-3-12)14-20-15(26-22-14)16(17,18)19/h2-5H,6-10H2,1H3/b21-11- |
| InChIKey | XAYVKAVMRFRCGF-NHDPSOOVSA-N |
| XLogP | 2.94 |
| TPSA | 72.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|