C17H17F3N4O3S — CID 166924962
1-[3-(ethylsulfanylmethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone (PubChem CID 166924962) has the molecular formula C17H17F3N4O3S and a molecular weight of 414.41 g/mol. Its IUPAC name is 1-[3-(ethylsulfanylmethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone.
| Compound Name | 1-[3-(ethylsulfanylmethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 166924962 |
| Molecular Formula | C17H17F3N4O3S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1-[3-(ethylsulfanylmethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone |
| SMILES | CCSCON=C1CN(C(=O)Cc2ccc(-c3noc(C(F)(F)F)n3)cc2)C1 |
| InChI | InChI=1S/C17H17F3N4O3S/c1-2-28-10-26-22-13-8-24(9-13)14(25)7-11-3-5-12(6-4-11)15-21-16(27-23-15)17(18,19)20/h3-6H,2,7-10H2,1H3 |
| InChIKey | YJNBKAXVURRWTF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|