C16H12F6N4O3 — CID 166924969
1-[3-(2,2,2-trifluoroethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone (PubChem CID 166924969) has the molecular formula C16H12F6N4O3 and a molecular weight of 422.29 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 166924969 |
| Molecular Formula | C16H12F6N4O3 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxyimino)azetidin-1-yl]-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone |
| SMILES | O=C(Cc1ccc(-c2noc(C(F)(F)F)n2)cc1)N1CC(=NOCC(F)(F)F)C1 |
| InChI | InChI=1S/C16H12F6N4O3/c17-15(18,19)8-28-24-11-6-26(7-11)12(27)5-9-1-3-10(4-2-9)13-23-14(29-25-13)16(20,21)22/h1-4H,5-8H2 |
| InChIKey | NLHLMZKOHBNIGO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|