C23H18F3N5O4 — CID 71558584
6-(4-aminophenoxy)-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide (PubChem CID 71558584) has the molecular formula C23H18F3N5O4 and a molecular weight of 485.42 g/mol. Its IUPAC name is 6-(4-aminophenoxy)-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide.
| Compound Name | 6-(4-aminophenoxy)-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71558584 |
| Molecular Formula | C23H18F3N5O4 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 6-(4-aminophenoxy)-N-[2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenoxy]ethyl]pyridine-2-carboxamide |
| SMILES | Nc1ccc(Oc2cccc(C(=O)NCCOc3ccc(-c4noc(C(F)(F)F)n4)cc3)n2)cc1 |
| InChI | InChI=1S/C23H18F3N5O4/c24-23(25,26)22-30-20(31-35-22)14-4-8-16(9-5-14)33-13-12-28-21(32)18-2-1-3-19(29-18)34-17-10-6-15(27)7-11-17/h1-11H,12-13,27H2,(H,28,32) |
| InChIKey | GSDXJVWKPSKJKG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|