C15H16F3N4O4P — CID 162734295
3-[2-(diethoxyphosphorylmethyl)imidazo[1,2-a]pyridin-7-yl]-5-(trifluoromethyl)-1,2,4-oxadiazole (PubChem CID 162734295) has the molecular formula C15H16F3N4O4P and a molecular weight of 404.29 g/mol. Its IUPAC name is 3-[2-(diethoxyphosphorylmethyl)imidazo[1,2-a]pyridin-7-yl]-5-(trifluoromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-[2-(diethoxyphosphorylmethyl)imidazo[1,2-a]pyridin-7-yl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 162734295 |
| Molecular Formula | C15H16F3N4O4P |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 3-[2-(diethoxyphosphorylmethyl)imidazo[1,2-a]pyridin-7-yl]-5-(trifluoromethyl)-1,2,4-oxadiazole |
| SMILES | CCOP(=O)(Cc1cn2ccc(-c3noc(C(F)(F)F)n3)cc2n1)OCC |
| InChI | InChI=1S/C15H16F3N4O4P/c1-3-24-27(23,25-4-2)9-11-8-22-6-5-10(7-12(22)19-11)13-20-14(26-21-13)15(16,17)18/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | JVKOSHCIEKUUGJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|