C17H10ClF2N5O4 — CID 155192626
3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(1,2-oxazol-4-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 155192626) has the molecular formula C17H10ClF2N5O4 and a molecular weight of 421.75 g/mol. Its IUPAC name is 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(1,2-oxazol-4-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(1,2-oxazol-4-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155192626 |
| Molecular Formula | C17H10ClF2N5O4 |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 3-[[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]methylamino]-4-(1,2-oxazol-4-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NCc2ccc(-c3noc(C(F)(F)Cl)n3)cc2)c(Nc2cnoc2)c1=O |
| InChI | InChI=1S/C17H10ClF2N5O4/c18-17(19,20)16-24-15(25-29-16)9-3-1-8(2-4-9)5-21-11-12(14(27)13(11)26)23-10-6-22-28-7-10/h1-4,6-7,21,23H,5H2 |
| InChIKey | SMNNBZPIMMMJPI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|