C15H8ClF2N2O3S- — CID 175182291
2-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]benzenesulfinate (PubChem CID 175182291) has the molecular formula C15H8ClF2N2O3S- and a molecular weight of 369.76 g/mol. Its IUPAC name is 2-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]benzenesulfinate.
| Compound Name | 2-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]benzenesulfinate |
|---|---|
| PubChem CID | 175182291 |
| Molecular Formula | C15H8ClF2N2O3S- |
| Molecular Weight | 369.76 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 2-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]benzenesulfinate |
| SMILES | O=S([O-])c1ccccc1-c1ccc(-c2noc(C(F)(F)Cl)n2)cc1 |
| InChI | InChI=1S/C15H9ClF2N2O3S/c16-15(17,18)14-19-13(20-23-14)10-7-5-9(6-8-10)11-3-1-2-4-12(11)24(21)22/h1-8H,(H,21,22)/p-1 |
| InChIKey | NABGKRNTUCPGNP-UHFFFAOYSA-M |
| XLogP | 3.93 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.76 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|