C17H10ClF3N2O2S — CID 155193215
1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(4-fluorophenyl)sulfanylethanone (PubChem CID 155193215) has the molecular formula C17H10ClF3N2O2S and a molecular weight of 398.79 g/mol. Its IUPAC name is 1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(4-fluorophenyl)sulfanylethanone.
| Compound Name | 1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(4-fluorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 155193215 |
| Molecular Formula | C17H10ClF3N2O2S |
| Molecular Weight | 398.79 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 1-[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-2-(4-fluorophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccc(F)cc1)c1ccc(-c2noc(C(F)(F)Cl)n2)cc1 |
| InChI | InChI=1S/C17H10ClF3N2O2S/c18-17(20,21)16-22-15(23-25-16)11-3-1-10(2-4-11)14(24)9-26-13-7-5-12(19)6-8-13/h1-8H,9H2 |
| InChIKey | GSUHTSKHHVZHOX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|