C14H8F3N3O2S2 — CID 155192795
2-(1,3-thiazol-2-ylsulfanyl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone (PubChem CID 155192795) has the molecular formula C14H8F3N3O2S2 and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylsulfanyl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone.
| Compound Name | 2-(1,3-thiazol-2-ylsulfanyl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 155192795 |
| Molecular Formula | C14H8F3N3O2S2 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-(1,3-thiazol-2-ylsulfanyl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethanone |
| SMILES | O=C(CSc1nccs1)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C14H8F3N3O2S2/c15-14(16,17)12-19-11(20-22-12)9-3-1-8(2-4-9)10(21)7-24-13-18-5-6-23-13/h1-6H,7H2 |
| InChIKey | LZZGBMZZVVQBDI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|