C13H9ClF2N6O — CID 155744148
5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)pyrimidin-2-amine (PubChem CID 155744148) has the molecular formula C13H9ClF2N6O and a molecular weight of 338.71 g/mol. Its IUPAC name is 5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 155744148 |
| Molecular Formula | C13H9ClF2N6O |
| Molecular Weight | 338.71 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-N-(pyridin-2-ylmethyl)pyrimidin-2-amine |
| SMILES | FC(F)(Cl)c1nc(-c2cnc(NCc3ccccn3)nc2)no1 |
| InChI | InChI=1S/C13H9ClF2N6O/c14-13(15,16)11-21-10(22-23-11)8-5-18-12(19-6-8)20-7-9-3-1-2-4-17-9/h1-6H,7H2,(H,18,19,20) |
| InChIKey | AJFKYXZBZFKLQB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|