C9H9N5 — CID 123270108
N-(pyridin-2-ylmethyl)-1,3,5-triazin-2-amine (PubChem CID 123270108) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1,3,5-triazin-2-amine.
| Compound Name | N-(pyridin-2-ylmethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123270108 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1,3,5-triazin-2-amine |
| SMILES | c1ccc(CNc2ncncn2)nc1 |
| InChI | InChI=1S/C9H9N5/c1-2-4-11-8(3-1)5-12-9-13-6-10-7-14-9/h1-4,6-7H,5H2,(H,10,12,13,14) |
| InChIKey | UHXNGELYUNJESA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |