C10H8Cl2F3N3O — CID 175801188
[4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methanamine;hydrochloride (PubChem CID 175801188) has the molecular formula C10H8Cl2F3N3O and a molecular weight of 314.09 g/mol. Its IUPAC name is [4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methanamine;hydrochloride.
| Compound Name | [4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 175801188 |
| Molecular Formula | C10H8Cl2F3N3O |
| Molecular Weight | 314.09 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | [4-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]-2-fluorophenyl]methanamine;hydrochloride |
| SMILES | Cl.NCc1ccc(-c2noc(C(F)(F)Cl)n2)cc1F |
| InChI | InChI=1S/C10H7ClF3N3O.ClH/c11-10(13,14)9-16-8(17-18-9)5-1-2-6(4-15)7(12)3-5;/h1-3H,4,15H2;1H |
| InChIKey | LEJMIZOIFCZCTM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.09 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|