C14H11F4N3O3 — CID 137366797
N-[[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide (PubChem CID 137366797) has the molecular formula C14H11F4N3O3 and a molecular weight of 345.25 g/mol. Its IUPAC name is N-[[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide.
| Compound Name | N-[[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide |
|---|---|
| PubChem CID | 137366797 |
| Molecular Formula | C14H11F4N3O3 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide |
| SMILES | CCC(=O)C(=O)NCc1ccc(-c2noc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C14H11F4N3O3/c1-2-10(22)12(23)19-6-8-4-3-7(5-9(8)15)11-20-13(24-21-11)14(16,17)18/h3-5H,2,6H2,1H3,(H,19,23) |
| InChIKey | LGDKOXQUODNJBW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|