C15H14F3N3O3 — CID 137366721
N-[[2-methyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide (PubChem CID 137366721) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is N-[[2-methyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide.
| Compound Name | N-[[2-methyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide |
|---|---|
| PubChem CID | 137366721 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[[2-methyl-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-2-oxobutanamide |
| SMILES | CCC(=O)C(=O)NCc1ccc(-c2noc(C(F)(F)F)n2)cc1C |
| InChI | InChI=1S/C15H14F3N3O3/c1-3-11(22)13(23)19-7-10-5-4-9(6-8(10)2)12-20-14(24-21-12)15(16,17)18/h4-6H,3,7H2,1-2H3,(H,19,23) |
| InChIKey | LDGHTWGWIWZHLB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|