C12H7F6N3O2 — CID 140911406
N-[difluoro-[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide (PubChem CID 140911406) has the molecular formula C12H7F6N3O2 and a molecular weight of 339.20 g/mol. Its IUPAC name is N-[difluoro-[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide.
| Compound Name | N-[difluoro-[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 140911406 |
| Molecular Formula | C12H7F6N3O2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-[difluoro-[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NC(F)(F)c1ccc(-c2noc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C12H7F6N3O2/c1-5(22)20-12(17,18)7-3-2-6(4-8(7)13)9-19-10(23-21-9)11(14,15)16/h2-4H,1H3,(H,20,22) |
| InChIKey | YIELSYASIAKQKO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|