C11H5F6N3O3 — CID 145340171
[2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(difluoromethyl)carbamate (PubChem CID 145340171) has the molecular formula C11H5F6N3O3 and a molecular weight of 341.17 g/mol. Its IUPAC name is [2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(difluoromethyl)carbamate.
| Compound Name | [2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(difluoromethyl)carbamate |
|---|---|
| PubChem CID | 145340171 |
| Molecular Formula | C11H5F6N3O3 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | [2-fluoro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl] N-(difluoromethyl)carbamate |
| SMILES | O=C(NC(F)F)Oc1ccc(-c2noc(C(F)(F)F)n2)cc1F |
| InChI | InChI=1S/C11H5F6N3O3/c12-5-3-4(7-18-8(23-20-7)11(15,16)17)1-2-6(5)22-10(21)19-9(13)14/h1-3,9H,(H,19,21) |
| InChIKey | WGNBEMTZGHRTDK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|