C15H7Cl2F3N2O2 — CID 175183113
5-[chloro(difluoro)methyl]-3-[3-(2-chloro-4-fluorophenoxy)phenyl]-1,2,4-oxadiazole (PubChem CID 175183113) has the molecular formula C15H7Cl2F3N2O2 and a molecular weight of 375.13 g/mol. Its IUPAC name is 5-[chloro(difluoro)methyl]-3-[3-(2-chloro-4-fluorophenoxy)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[chloro(difluoro)methyl]-3-[3-(2-chloro-4-fluorophenoxy)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 175183113 |
| Molecular Formula | C15H7Cl2F3N2O2 |
| Molecular Weight | 375.13 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 5-[chloro(difluoro)methyl]-3-[3-(2-chloro-4-fluorophenoxy)phenyl]-1,2,4-oxadiazole |
| SMILES | Fc1ccc(Oc2cccc(-c3noc(C(F)(F)Cl)n3)c2)c(Cl)c1 |
| InChI | InChI=1S/C15H7Cl2F3N2O2/c16-11-7-9(18)4-5-12(11)23-10-3-1-2-8(6-10)13-21-14(24-22-13)15(17,19)20/h1-7H |
| InChIKey | IXAAIKRRIMXEDE-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.13 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|