C14H11ClF2N4OS — CID 175364924
[3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-(1-methylpyrazol-4-yl)methanethiol (PubChem CID 175364924) has the molecular formula C14H11ClF2N4OS and a molecular weight of 356.79 g/mol. Its IUPAC name is [3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-(1-methylpyrazol-4-yl)methanethiol.
| Compound Name | [3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-(1-methylpyrazol-4-yl)methanethiol |
|---|---|
| PubChem CID | 175364924 |
| Molecular Formula | C14H11ClF2N4OS |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | [3-[5-[chloro(difluoro)methyl]-1,2,4-oxadiazol-3-yl]phenyl]-(1-methylpyrazol-4-yl)methanethiol |
| SMILES | Cn1cc(C(S)c2cccc(-c3noc(C(F)(F)Cl)n3)c2)cn1 |
| InChI | InChI=1S/C14H11ClF2N4OS/c1-21-7-10(6-18-21)11(23)8-3-2-4-9(5-8)12-19-13(22-20-12)14(15,16)17/h2-7,11,23H,1H3 |
| InChIKey | NVKIABNDBJGUDJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|