C10H14N6O — CID 176527766
1-(diaminomethylidene)-2-(2-methylphenyl)guanidine;isocyanic acid (PubChem CID 176527766) has the molecular formula C10H14N6O and a molecular weight of 234.26 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2-methylphenyl)guanidine;isocyanic acid.
| Compound Name | 1-(diaminomethylidene)-2-(2-methylphenyl)guanidine;isocyanic acid |
|---|---|
| PubChem CID | 176527766 |
| Molecular Formula | C10H14N6O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2-methylphenyl)guanidine;isocyanic acid |
| SMILES | Cc1ccccc1/N=C(\N)N=C(N)N.N=C=O |
| InChI | InChI=1S/C9H13N5.CHNO/c1-6-4-2-3-5-7(6)13-9(12)14-8(10)11;2-1-3/h2-5H,1H3,(H6,10,11,12,13,14);2H |
| InChIKey | CCLDOLMODYXACW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 143.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|