C16H19N5S — CID 168602053
1-(diaminomethylidene)-2-[2-[(4-methylphenyl)methylsulfanyl]phenyl]guanidine (PubChem CID 168602053) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-[(4-methylphenyl)methylsulfanyl]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-[(4-methylphenyl)methylsulfanyl]phenyl]guanidine |
|---|---|
| PubChem CID | 168602053 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-[(4-methylphenyl)methylsulfanyl]phenyl]guanidine |
| SMILES | Cc1ccc(CSc2ccccc2/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C16H19N5S/c1-11-6-8-12(9-7-11)10-22-14-5-3-2-4-13(14)20-16(19)21-15(17)18/h2-9H,10H2,1H3,(H6,17,18,19,20,21) |
| InChIKey | GYTYKLFHKHEYBK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|