C17H21N5O — CID 168602050
1-(diaminomethylidene)-2-[2-(3-phenylpropoxy)phenyl]guanidine (PubChem CID 168602050) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(3-phenylpropoxy)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(3-phenylpropoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 168602050 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(3-phenylpropoxy)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C17H21N5O/c18-16(19)22-17(20)21-14-10-4-5-11-15(14)23-12-6-9-13-7-2-1-3-8-13/h1-5,7-8,10-11H,6,9,12H2,(H6,18,19,20,21,22) |
| InChIKey | BIKNYRILCSPGIO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|