C10H15N5O — CID 168601501
1-(diaminomethylidene)-2-[2-(2-hydroxyethyl)phenyl]guanidine (PubChem CID 168601501) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(2-hydroxyethyl)phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(2-hydroxyethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 168601501 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(2-hydroxyethyl)phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1CCO |
| InChI | InChI=1S/C10H15N5O/c11-9(12)15-10(13)14-8-4-2-1-3-7(8)5-6-16/h1-4,16H,5-6H2,(H6,11,12,13,14,15) |
| InChIKey | WGCADRBALFXMOZ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|