C8H11ClIN5 — CID 146317046
1-(diaminomethylidene)-2-(2-iodophenyl)guanidine;hydrochloride (PubChem CID 146317046) has the molecular formula C8H11ClIN5 and a molecular weight of 339.57 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2-iodophenyl)guanidine;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-2-(2-iodophenyl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 146317046 |
| Molecular Formula | C8H11ClIN5 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2-iodophenyl)guanidine;hydrochloride |
| SMILES | Cl.NC(N)=N/C(N)=N/c1ccccc1I |
| InChI | InChI=1S/C8H10IN5.ClH/c9-5-3-1-2-4-6(5)13-8(12)14-7(10)11;/h1-4H,(H6,10,11,12,13,14);1H |
| InChIKey | BLVIDBNWVKTDEI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|