C16H13N5O2 — CID 168606063
1-(diaminomethylidene)-2-(9,10-dioxoanthracen-1-yl)guanidine (PubChem CID 168606063) has the molecular formula C16H13N5O2 and a molecular weight of 307.31 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(9,10-dioxoanthracen-1-yl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(9,10-dioxoanthracen-1-yl)guanidine |
|---|---|
| PubChem CID | 168606063 |
| Molecular Formula | C16H13N5O2 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-(diaminomethylidene)-2-(9,10-dioxoanthracen-1-yl)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H13N5O2/c17-15(18)21-16(19)20-11-7-3-6-10-12(11)14(23)9-5-2-1-4-8(9)13(10)22/h1-7H,(H6,17,18,19,20,21) |
| InChIKey | WPIPNVWSTSAZGR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|