C17H16N6O2 — CID 168604612
1-(diaminomethylidene)-2-[2-(2-methylphenyl)-1,3-dioxoisoindol-4-yl]guanidine (PubChem CID 168604612) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(2-methylphenyl)-1,3-dioxoisoindol-4-yl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(2-methylphenyl)-1,3-dioxoisoindol-4-yl]guanidine |
|---|---|
| PubChem CID | 168604612 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(2-methylphenyl)-1,3-dioxoisoindol-4-yl]guanidine |
| SMILES | Cc1ccccc1N1C(=O)c2cccc(/N=C(\N)N=C(N)N)c2C1=O |
| InChI | InChI=1S/C17H16N6O2/c1-9-5-2-3-8-12(9)23-14(24)10-6-4-7-11(13(10)15(23)25)21-17(20)22-16(18)19/h2-8H,1H3,(H6,18,19,20,21,22) |
| InChIKey | TYTQWXQQUZTQAG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|