C15H10BrNO2 — CID 169336941
4-bromo-2-(2-methylphenyl)isoindole-1,3-dione (PubChem CID 169336941) has the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. Its IUPAC name is 4-bromo-2-(2-methylphenyl)isoindole-1,3-dione.
| Compound Name | 4-bromo-2-(2-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 169336941 |
| Molecular Formula | C15H10BrNO2 |
| Molecular Weight | 316.15 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 4-bromo-2-(2-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1ccccc1N1C(=O)c2cccc(Br)c2C1=O |
| InChI | InChI=1S/C15H10BrNO2/c1-9-5-2-3-8-12(9)17-14(18)10-6-4-7-11(16)13(10)15(17)19/h2-8H,1H3 |
| InChIKey | WWPKIVJRWMPBFW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|