C21H14BrNO2S — CID 18208409
(4E)-4-[(5-bromothiophen-2-yl)methylidene]-2-(2-methylphenyl)isoquinoline-1,3-dione (PubChem CID 18208409) has the molecular formula C21H14BrNO2S and a molecular weight of 424.32 g/mol. Its IUPAC name is (4E)-4-[(5-bromothiophen-2-yl)methylidene]-2-(2-methylphenyl)isoquinoline-1,3-dione.
| Compound Name | (4E)-4-[(5-bromothiophen-2-yl)methylidene]-2-(2-methylphenyl)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 18208409 |
| Molecular Formula | C21H14BrNO2S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | (4E)-4-[(5-bromothiophen-2-yl)methylidene]-2-(2-methylphenyl)isoquinoline-1,3-dione |
| SMILES | Cc1ccccc1N1C(=O)/C(=C/c2ccc(Br)s2)c2ccccc2C1=O |
| InChI | InChI=1S/C21H14BrNO2S/c1-13-6-2-5-9-18(13)23-20(24)16-8-4-3-7-15(16)17(21(23)25)12-14-10-11-19(22)26-14/h2-12H,1H3/b17-12+ |
| InChIKey | ULTOBKNDXHPLGX-SFQUDFHCSA-N |
| XLogP | 5.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|