C28H20FN3O3S — CID 43012017
N-(2-fluorophenyl)-N-[4-[(E)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 43012017) has the molecular formula C28H20FN3O3S and a molecular weight of 497.55 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-[4-[(E)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-N-[4-[(E)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 43012017 |
| Molecular Formula | C28H20FN3O3S |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N-(2-fluorophenyl)-N-[4-[(E)-[2-(2-methylphenyl)-1,3-dioxoisoquinolin-4-ylidene]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1nc(/C=C2/C(=O)N(c3ccccc3C)C(=O)c3ccccc32)cs1)c1ccccc1F |
| InChI | InChI=1S/C28H20FN3O3S/c1-17-9-3-7-13-24(17)32-26(34)21-11-5-4-10-20(21)22(27(32)35)15-19-16-36-28(30-19)31(18(2)33)25-14-8-6-12-23(25)29/h3-16H,1-2H3/b22-15+ |
| InChIKey | HZKYGUGGISYCGO-PXLXIMEGSA-N |
| XLogP | 6.00 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|