C20H14ClFN2O2S — CID 8833043
N-[4-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 8833043) has the molecular formula C20H14ClFN2O2S and a molecular weight of 400.86 g/mol. Its IUPAC name is N-[4-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | N-[4-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 8833043 |
| Molecular Formula | C20H14ClFN2O2S |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[4-[(E)-3-(4-chlorophenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CC(=O)N(c1nc(/C=C/C(=O)c2ccc(Cl)cc2)cs1)c1ccccc1F |
| InChI | InChI=1S/C20H14ClFN2O2S/c1-13(25)24(18-5-3-2-4-17(18)22)20-23-16(12-27-20)10-11-19(26)14-6-8-15(21)9-7-14/h2-12H,1H3/b11-10+ |
| InChIKey | YSHOPNYHMRBUQQ-ZHACJKMWSA-N |
| XLogP | 5.52 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|