C22H19FN2O2S — CID 9448432
N-[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 9448432) has the molecular formula C22H19FN2O2S and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | N-[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9448432 |
| Molecular Formula | C22H19FN2O2S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[4-[(E)-3-(2,4-dimethylphenyl)-3-oxoprop-1-enyl]-1,3-thiazol-2-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | CC(=O)N(c1nc(/C=C/C(=O)c2ccc(C)cc2C)cs1)c1ccccc1F |
| InChI | InChI=1S/C22H19FN2O2S/c1-14-8-10-18(15(2)12-14)21(27)11-9-17-13-28-22(24-17)25(16(3)26)20-7-5-4-6-19(20)23/h4-13H,1-3H3/b11-9+ |
| InChIKey | AZIZXCZNAGMOPN-PKNBQFBNSA-N |
| XLogP | 5.48 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|