C22H19BrFN3O2S — CID 60575442
(E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-bromo-2-methylphenyl)-N-methylprop-2-enamide (PubChem CID 60575442) has the molecular formula C22H19BrFN3O2S and a molecular weight of 488.38 g/mol. Its IUPAC name is (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-bromo-2-methylphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-bromo-2-methylphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 60575442 |
| Molecular Formula | C22H19BrFN3O2S |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | (E)-3-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]-N-(4-bromo-2-methylphenyl)-N-methylprop-2-enamide |
| SMILES | CC(=O)N(c1nc(/C=C/C(=O)N(C)c2ccc(Br)cc2C)cs1)c1ccccc1F |
| InChI | InChI=1S/C22H19BrFN3O2S/c1-14-12-16(23)8-10-19(14)26(3)21(29)11-9-17-13-30-22(25-17)27(15(2)28)20-7-5-4-6-18(20)24/h4-13H,1-3H3/b11-9+ |
| InChIKey | TYXQLSHQKNJGHL-PKNBQFBNSA-N |
| XLogP | 5.71 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|