C12H9FN2O2S — CID 2090927
N-(2-fluorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide (PubChem CID 2090927) has the molecular formula C12H9FN2O2S and a molecular weight of 264.28 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(2-fluorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2090927 |
| Molecular Formula | C12H9FN2O2S |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | N-(2-fluorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)N(c1nc(C=O)cs1)c1ccccc1F |
| InChI | InChI=1S/C12H9FN2O2S/c1-8(17)15(11-5-3-2-4-10(11)13)12-14-9(6-16)7-18-12/h2-7H,1H3 |
| InChIKey | HKXBJGNKEAENBS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|