C19H15FN4O3S — CID 9077876
N-[(Z)-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methylideneamino]-2-hydroxybenzamide (PubChem CID 9077876) has the molecular formula C19H15FN4O3S and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[(Z)-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(Z)-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 9077876 |
| Molecular Formula | C19H15FN4O3S |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-[(Z)-[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methylideneamino]-2-hydroxybenzamide |
| SMILES | CC(=O)N(c1nc(/C=N\NC(=O)c2ccccc2O)cs1)c1ccccc1F |
| InChI | InChI=1S/C19H15FN4O3S/c1-12(25)24(16-8-4-3-7-15(16)20)19-22-13(11-28-19)10-21-23-18(27)14-6-2-5-9-17(14)26/h2-11,26H,1H3,(H,23,27)/b21-10- |
| InChIKey | PQZHDLPRLDVDCS-FBHDLOMBSA-N |
| XLogP | 3.44 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|