C19H16F2N4OS — CID 9059425
N-(2,4-difluorophenyl)-N-[4-[(Z)-[(4-methylphenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 9059425) has the molecular formula C19H16F2N4OS and a molecular weight of 386.43 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-[4-[(Z)-[(4-methylphenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-N-[4-[(Z)-[(4-methylphenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9059425 |
| Molecular Formula | C19H16F2N4OS |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-[4-[(Z)-[(4-methylphenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1nc(/C=N\Nc2ccc(C)cc2)cs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H16F2N4OS/c1-12-3-6-15(7-4-12)24-22-10-16-11-27-19(23-16)25(13(2)26)18-8-5-14(20)9-17(18)21/h3-11,24H,1-2H3/b22-10- |
| InChIKey | QFHAKVBSRPLBJP-YVNNLAQVSA-N |
| XLogP | 4.86 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|