C21H19FN4O2S — CID 9016676
N-[(Z)-[2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]-4-fluorobenzamide (PubChem CID 9016676) has the molecular formula C21H19FN4O2S and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[(Z)-[2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]-4-fluorobenzamide.
| Compound Name | N-[(Z)-[2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 9016676 |
| Molecular Formula | C21H19FN4O2S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-[(Z)-[2-(N-acetyl-3,4-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]-4-fluorobenzamide |
| SMILES | CC(=O)N(c1ccc(C)c(C)c1)c1nc(/C=N\NC(=O)c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C21H19FN4O2S/c1-13-4-9-19(10-14(13)2)26(15(3)27)21-24-18(12-29-21)11-23-25-20(28)16-5-7-17(22)8-6-16/h4-12H,1-3H3,(H,25,28)/b23-11- |
| InChIKey | ZDGQESPWYNLOPH-KSEXSDGBSA-N |
| XLogP | 4.35 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|