C14H13ClN4O2S — CID 9073997
N-[(Z)-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]methylideneamino]acetamide (PubChem CID 9073997) has the molecular formula C14H13ClN4O2S and a molecular weight of 336.80 g/mol. Its IUPAC name is N-[(Z)-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]methylideneamino]acetamide.
| Compound Name | N-[(Z)-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 9073997 |
| Molecular Formula | C14H13ClN4O2S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-[(Z)-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]methylideneamino]acetamide |
| SMILES | CC(=O)N/N=C\c1csc(N(C(C)=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H13ClN4O2S/c1-9(20)18-16-7-12-8-22-14(17-12)19(10(2)21)13-5-3-4-11(15)6-13/h3-8H,1-2H3,(H,18,20)/b16-7- |
| InChIKey | USLGEHMIZPHVPZ-APSNUPSMSA-N |
| XLogP | 2.95 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|