C15H12ClN5O3S — CID 9351274
N-(3-chlorophenyl)-N-[4-[(Z)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 9351274) has the molecular formula C15H12ClN5O3S and a molecular weight of 377.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[4-[(Z)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-N-[4-[(Z)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9351274 |
| Molecular Formula | C15H12ClN5O3S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-(3-chlorophenyl)-N-[4-[(Z)-(2,4-dioxoimidazolidin-1-yl)iminomethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)N(c1cccc(Cl)c1)c1nc(/C=N\N2CC(=O)NC2=O)cs1 |
| InChI | InChI=1S/C15H12ClN5O3S/c1-9(22)21(12-4-2-3-10(16)5-12)15-18-11(8-25-15)6-17-20-7-13(23)19-14(20)24/h2-6,8H,7H2,1H3,(H,19,23,24)/b17-6- |
| InChIKey | PDADBQJMCDNTBP-FMQZQXMHSA-N |
| XLogP | 2.37 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|