C18H16ClN3O4S — CID 18290451
2-methoxyethyl (E)-3-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 18290451) has the molecular formula C18H16ClN3O4S and a molecular weight of 405.86 g/mol. Its IUPAC name is 2-methoxyethyl (E)-3-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | 2-methoxyethyl (E)-3-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 18290451 |
| Molecular Formula | C18H16ClN3O4S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-methoxyethyl (E)-3-[2-(N-acetyl-3-chloroanilino)-1,3-thiazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | COCCOC(=O)/C(C#N)=C/c1csc(N(C(C)=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C18H16ClN3O4S/c1-12(23)22(16-5-3-4-14(19)9-16)18-21-15(11-27-18)8-13(10-20)17(24)26-7-6-25-2/h3-5,8-9,11H,6-7H2,1-2H3/b13-8+ |
| InChIKey | WOBPXBQMVMBXFJ-MDWZMJQESA-N |
| XLogP | 3.58 |
| TPSA | 92.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|