C14H14ClN5OS2 — CID 9071789
N-(3-chlorophenyl)-N-[4-[(Z)-(methylcarbamothioylhydrazinylidene)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 9071789) has the molecular formula C14H14ClN5OS2 and a molecular weight of 367.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[4-[(Z)-(methylcarbamothioylhydrazinylidene)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-N-[4-[(Z)-(methylcarbamothioylhydrazinylidene)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 9071789 |
| Molecular Formula | C14H14ClN5OS2 |
| Molecular Weight | 367.89 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | N-(3-chlorophenyl)-N-[4-[(Z)-(methylcarbamothioylhydrazinylidene)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CNC(=S)N/N=C\c1csc(N(C(C)=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H14ClN5OS2/c1-9(21)20(12-5-3-4-10(15)6-12)14-18-11(8-23-14)7-17-19-13(22)16-2/h3-8H,1-2H3,(H2,16,19,22)/b17-7- |
| InChIKey | UJSVGWNQPGOSOO-IDUWFGFVSA-N |
| XLogP | 2.91 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|