C16H17N5O3S — CID 9120876
N'-[(Z)-[2-(N-acetyl-2,6-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]oxamide (PubChem CID 9120876) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is N'-[(Z)-[2-(N-acetyl-2,6-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]oxamide.
| Compound Name | N'-[(Z)-[2-(N-acetyl-2,6-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 9120876 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N'-[(Z)-[2-(N-acetyl-2,6-dimethylanilino)-1,3-thiazol-4-yl]methylideneamino]oxamide |
| SMILES | CC(=O)N(c1nc(/C=N\NC(=O)C(N)=O)cs1)c1c(C)cccc1C |
| InChI | InChI=1S/C16H17N5O3S/c1-9-5-4-6-10(2)13(9)21(11(3)22)16-19-12(8-25-16)7-18-20-15(24)14(17)23/h4-8H,1-3H3,(H2,17,23)(H,20,24)/b18-7- |
| InChIKey | WFFISYSWFJPVOZ-WSVATBPTSA-N |
| XLogP | 1.38 |
| TPSA | 117.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|