C14H15N5O3S — CID 9017330
N-[4-[(Z)-(carbamoylhydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 9017330) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is N-[4-[(Z)-(carbamoylhydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | N-[4-[(Z)-(carbamoylhydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9017330 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[4-[(Z)-(carbamoylhydrazinylidene)methyl]-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(N(C(C)=O)c2nc(/C=N\NC(N)=O)cs2)cc1 |
| InChI | InChI=1S/C14H15N5O3S/c1-9(20)19(11-3-5-12(22-2)6-4-11)14-17-10(8-23-14)7-16-18-13(15)21/h3-8H,1-2H3,(H3,15,18,21)/b16-7- |
| InChIKey | LYUBVVIIBMGSHT-APSNUPSMSA-N |
| XLogP | 1.84 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|