C20H18F2N4OS — CID 9058415
N-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 9058415) has the molecular formula C20H18F2N4OS and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | N-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 9058415 |
| Molecular Formula | C20H18F2N4OS |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[4-[(Z)-[(2,4-difluorophenyl)hydrazinylidene]methyl]-1,3-thiazol-2-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CC(=O)N(c1nc(/C=N\Nc2ccc(F)cc2F)cs1)c1c(C)cccc1C |
| InChI | InChI=1S/C20H18F2N4OS/c1-12-5-4-6-13(2)19(12)26(14(3)27)20-24-16(11-28-20)10-23-25-18-8-7-15(21)9-17(18)22/h4-11,25H,1-3H3/b23-10- |
| InChIKey | IXVVWBSPKKWBIJ-RMORIDSASA-N |
| XLogP | 5.17 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|