C12H9ClN2O2S — CID 3728040
N-(3-chlorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide (PubChem CID 3728040) has the molecular formula C12H9ClN2O2S and a molecular weight of 280.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-(3-chlorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3728040 |
| Molecular Formula | C12H9ClN2O2S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | N-(3-chlorophenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)N(c1cccc(Cl)c1)c1nc(C=O)cs1 |
| InChI | InChI=1S/C12H9ClN2O2S/c1-8(17)15(11-4-2-3-9(13)5-11)12-14-10(6-16)7-18-12/h2-7H,1H3 |
| InChIKey | PBBRLJUFVBUNIC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|