C21H14ClN3O3S — CID 26496643
N-[4-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide (PubChem CID 26496643) has the molecular formula C21H14ClN3O3S and a molecular weight of 423.88 g/mol. Its IUPAC name is N-[4-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide.
| Compound Name | N-[4-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 26496643 |
| Molecular Formula | C21H14ClN3O3S |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | N-[4-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-1,3-thiazol-2-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)c1nc(/C=C2\N=C(c3cccc(Cl)c3)OC2=O)cs1 |
| InChI | InChI=1S/C21H14ClN3O3S/c1-13(26)25(17-8-3-2-4-9-17)21-23-16(12-29-21)11-18-20(27)28-19(24-18)14-6-5-7-15(22)10-14/h2-12H,1H3/b18-11- |
| InChIKey | OHUWKIPAFZRUGB-WQRHYEAKSA-N |
| XLogP | 4.83 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|