C14H7BrClNO2S — CID 47024923
(4E)-4-[(5-bromothiophen-3-yl)methylidene]-2-(3-chlorophenyl)-1,3-oxazol-5-one (PubChem CID 47024923) has the molecular formula C14H7BrClNO2S and a molecular weight of 368.64 g/mol. Its IUPAC name is (4E)-4-[(5-bromothiophen-3-yl)methylidene]-2-(3-chlorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4E)-4-[(5-bromothiophen-3-yl)methylidene]-2-(3-chlorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 47024923 |
| Molecular Formula | C14H7BrClNO2S |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | (4E)-4-[(5-bromothiophen-3-yl)methylidene]-2-(3-chlorophenyl)-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccc(Cl)c2)=N/C1=C/c1csc(Br)c1 |
| InChI | InChI=1S/C14H7BrClNO2S/c15-12-5-8(7-20-12)4-11-14(18)19-13(17-11)9-2-1-3-10(16)6-9/h1-7H/b11-4+ |
| InChIKey | HQDPVLAHTPRTQH-NYYWCZLTSA-N |
| XLogP | 4.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|