C18H11ClN2O3 — CID 97433512
2-[3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 97433512) has the molecular formula C18H11ClN2O3 and a molecular weight of 338.75 g/mol. Its IUPAC name is 2-[3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 97433512 |
| Molecular Formula | C18H11ClN2O3 |
| Molecular Weight | 338.75 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-[3-[(Z)-[2-(3-chlorophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(/C=C2\N=C(c3cccc(Cl)c3)OC2=O)c1 |
| InChI | InChI=1S/C18H11ClN2O3/c19-14-5-2-4-13(11-14)17-21-16(18(22)24-17)10-12-3-1-6-15(9-12)23-8-7-20/h1-6,9-11H,8H2/b16-10- |
| InChIKey | WJLANFSKFGUAEM-YBEGLDIGSA-N |
| XLogP | 3.59 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|