C20H16N2O3 — CID 47046665
2-[3-[(E)-[2-(3,5-dimethylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 47046665) has the molecular formula C20H16N2O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-[3-[(E)-[2-(3,5-dimethylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[3-[(E)-[2-(3,5-dimethylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 47046665 |
| Molecular Formula | C20H16N2O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[3-[(E)-[2-(3,5-dimethylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | Cc1cc(C)cc(C2=N/C(=C/c3cccc(OCC#N)c3)C(=O)O2)c1 |
| InChI | InChI=1S/C20H16N2O3/c1-13-8-14(2)10-16(9-13)19-22-18(20(23)25-19)12-15-4-3-5-17(11-15)24-7-6-21/h3-5,8-12H,7H2,1-2H3/b18-12+ |
| InChIKey | IFKJBZVYLXKCPT-LDADJPATSA-N |
| XLogP | 3.55 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|